C19H26O5 — CID 101384768
(1S,4S,7R,8S,12S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-7-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one (PubChem CID 101384768) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1S,4S,7R,8S,12S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-7-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one.
| Compound Name | (1S,4S,7R,8S,12S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-7-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one |
|---|---|
| PubChem CID | 101384768 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1S,4S,7R,8S,12S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-7-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one |
| SMILES | CO[C@@]12OC[C@H]3C=C[C@@H](C)[C@@](C4OCC(C)(C)CO4)(C=CC1=O)[C@H]32 |
| InChI | InChI=1S/C19H26O5/c1-12-5-6-13-9-24-19(21-4)14(20)7-8-18(12,15(13)19)16-22-10-17(2,3)11-23-16/h5-8,12-13,15-16H,9-11H2,1-4H3/t12-,13-,15+,18+,19-/m1/s1 |
| InChIKey | XFNWOKZTSQTJMS-VULJSJLBSA-N |
| XLogP | 2.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|