C11H18O3 — CID 101385051
(4S,6S)-4,6-dihydroxy-4,6-dimethylnona-1,8-dien-5-one (PubChem CID 101385051) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (4S,6S)-4,6-dihydroxy-4,6-dimethylnona-1,8-dien-5-one.
| Compound Name | (4S,6S)-4,6-dihydroxy-4,6-dimethylnona-1,8-dien-5-one |
|---|---|
| PubChem CID | 101385051 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (4S,6S)-4,6-dihydroxy-4,6-dimethylnona-1,8-dien-5-one |
| SMILES | C=CC[C@](C)(O)C(=O)[C@@](C)(O)CC=C |
| InChI | InChI=1S/C11H18O3/c1-5-7-10(3,13)9(12)11(4,14)8-6-2/h5-6,13-14H,1-2,7-8H2,3-4H3/t10-,11-/m0/s1 |
| InChIKey | KMPYVUFBKITALH-QWRGUYRKSA-N |
| XLogP | 1.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|