C17H30O5 — CID 101385055
tert-butyl 2-[(4R,5R,6S)-5-hydroxy-2,2,4,6-tetramethyl-5-prop-2-enyl-1,3-dioxan-4-yl]acetate (PubChem CID 101385055) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is tert-butyl 2-[(4R,5R,6S)-5-hydroxy-2,2,4,6-tetramethyl-5-prop-2-enyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,5R,6S)-5-hydroxy-2,2,4,6-tetramethyl-5-prop-2-enyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 101385055 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | tert-butyl 2-[(4R,5R,6S)-5-hydroxy-2,2,4,6-tetramethyl-5-prop-2-enyl-1,3-dioxan-4-yl]acetate |
| SMILES | C=CC[C@@]1(O)[C@H](C)OC(C)(C)O[C@]1(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30O5/c1-9-10-17(19)12(2)20-15(6,7)22-16(17,8)11-13(18)21-14(3,4)5/h9,12,19H,1,10-11H2,2-8H3/t12-,16+,17+/m0/s1 |
| InChIKey | LDKKUYMYXIBCIL-JCURWCKSSA-N |
| XLogP | 2.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|