C17H24O4 — CID 101385567
methyl (Z)-5-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-hydroxy-3-oxopent-4-enoate (PubChem CID 101385567) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (Z)-5-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-hydroxy-3-oxopent-4-enoate.
| Compound Name | methyl (Z)-5-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-hydroxy-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 101385567 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | methyl (Z)-5-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-5-hydroxy-3-oxopent-4-enoate |
| SMILES | COC(=O)CC(=O)/C=C(\O)[C@H]1[C@@H]2CCCC[C@H]2C=C[C@H]1C |
| InChI | InChI=1S/C17H24O4/c1-11-7-8-12-5-3-4-6-14(12)17(11)15(19)9-13(18)10-16(20)21-2/h7-9,11-12,14,17,19H,3-6,10H2,1-2H3/b15-9-/t11-,12+,14-,17-/m1/s1 |
| InChIKey | UQWDBELZHGRQER-NRNXYQPXSA-N |
| XLogP | 3.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|