C13H12N3NaO8 — CID 101385788
sodium 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]methyl]oxolan-2-yl]-2-oxopyrimidin-4-olate (PubChem CID 101385788) has the molecular formula C13H12N3NaO8 and a molecular weight of 361.24 g/mol. Its IUPAC name is sodium 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]methyl]oxolan-2-yl]-2-oxopyrimidin-4-olate.
| Compound Name | sodium 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]methyl]oxolan-2-yl]-2-oxopyrimidin-4-olate |
|---|---|
| PubChem CID | 101385788 |
| Molecular Formula | C13H12N3NaO8 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | sodium 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(2-hydroxy-3,4-dioxocyclobuten-1-yl)amino]methyl]oxolan-2-yl]-2-oxopyrimidin-4-olate |
| SMILES | O=c1c(O)c(NC[C@H]2O[C@@H](n3ccc([O-])nc3=O)[C@H](O)[C@@H]2O)c1=O.[Na+] |
| InChI | InChI=1S/C13H13N3O8.Na/c17-5-1-2-16(13(23)15-5)12-11(22)7(18)4(24-12)3-14-6-8(19)10(21)9(6)20;/h1-2,4,7,11-12,14,18-19,22H,3H2,(H,15,17,23);/q;+1/p-1/t4-,7-,11-,12-;/m1./s1 |
| InChIKey | RZPWKLMHLMXGGO-AJQXAYQBSA-M |
| XLogP | -6.65 |
| TPSA | 174.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|