C23H33N3O6 — CID 10138598
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(6-methoxypyridazin-3-yl)amino]acetate (PubChem CID 10138598) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(6-methoxypyridazin-3-yl)amino]acetate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(6-methoxypyridazin-3-yl)amino]acetate |
|---|---|
| PubChem CID | 10138598 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(6-methoxypyridazin-3-yl)amino]acetate |
| SMILES | COc1ccc(NCC(=O)O[C@@H]2CC[C@]3(CO3)[C@@H]([C@]3(C)O[C@@H]3CC=C(C)C)[C@@H]2OC)nn1 |
| InChI | InChI=1S/C23H33N3O6/c1-14(2)6-7-16-22(3,32-16)21-20(29-5)15(10-11-23(21)13-30-23)31-19(27)12-24-17-8-9-18(28-4)26-25-17/h6,8-9,15-16,20-21H,7,10-13H2,1-5H3,(H,24,25)/t15-,16-,20-,21-,22-,23+/m1/s1 |
| InChIKey | JMYGVIRGYQYAFC-CDEZGAEXSA-N |
| XLogP | 2.52 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|