C18H20O3 — CID 101386040
9,10-dihydroxy-4,4,6,7-tetramethyl-2,3-dihydroanthracen-1-one (PubChem CID 101386040) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 9,10-dihydroxy-4,4,6,7-tetramethyl-2,3-dihydroanthracen-1-one.
| Compound Name | 9,10-dihydroxy-4,4,6,7-tetramethyl-2,3-dihydroanthracen-1-one |
|---|---|
| PubChem CID | 101386040 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 9,10-dihydroxy-4,4,6,7-tetramethyl-2,3-dihydroanthracen-1-one |
| SMILES | Cc1cc2c(O)c3c(c(O)c2cc1C)C(C)(C)CCC3=O |
| InChI | InChI=1S/C18H20O3/c1-9-7-11-12(8-10(9)2)17(21)15-14(16(11)20)13(19)5-6-18(15,3)4/h7-8,20-21H,5-6H2,1-4H3 |
| InChIKey | BBZGVRBHSVGYBL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|