About 5,6-dihydroxycyclohexa-2,4-dien-1-one
5,6-dihydroxycyclohexa-2,4-dien-1-one (PubChem CID 101386046) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is 5,6-dihydroxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 5,6-dihydroxycyclohexa-2,4-dien-1-one |
| PubChem CID | 101386046 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 5,6-dihydroxycyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C(O)C1O |
| InChI | InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,6-7,9H |
| InChIKey | UZOKZOGZSBYLIK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydroxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxycyclohexa-2,4-dien-1-one?
The IUPAC name of 5,6-dihydroxycyclohexa-2,4-dien-1-one (CID 101386046) is 5,6-dihydroxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 5,6-dihydroxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 5,6-dihydroxycyclohexa-2,4-dien-1-one is O=C1C=CC=C(O)C1O.
What is the InChIKey of 5,6-dihydroxycyclohexa-2,4-dien-1-one?
The InChIKey is UZOKZOGZSBYLIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,6-7,9H.
What are the key properties of 5,6-dihydroxycyclohexa-2,4-dien-1-one?
5,6-dihydroxycyclohexa-2,4-dien-1-one has a molecular weight of 126.11 g/mol, XLogP of -0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 101386046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).