C19H20BrNO3S — CID 101386511
(3R)-8-(4-bromophenyl)-5-oxo-7-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid (PubChem CID 101386511) has the molecular formula C19H20BrNO3S and a molecular weight of 422.34 g/mol. Its IUPAC name is (3R)-8-(4-bromophenyl)-5-oxo-7-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid.
| Compound Name | (3R)-8-(4-bromophenyl)-5-oxo-7-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 101386511 |
| Molecular Formula | C19H20BrNO3S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (3R)-8-(4-bromophenyl)-5-oxo-7-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
| SMILES | CCCCCc1cc(=O)n2c(c1-c1ccc(Br)cc1)SC[C@H]2C(=O)O |
| InChI | InChI=1S/C19H20BrNO3S/c1-2-3-4-5-13-10-16(22)21-15(19(23)24)11-25-18(21)17(13)12-6-8-14(20)9-7-12/h6-10,15H,2-5,11H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | TYRSZQOIKWBWKP-HNNXBMFYSA-N |
| XLogP | 4.74 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|