C36H48N12+6 — CID 101387085
1-methyl-3-[[2,3,4,5,6-pentakis[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methyl]imidazol-1-ium (PubChem CID 101387085) has the molecular formula C36H48N12+6 and a molecular weight of 648.86 g/mol. Its IUPAC name is 1-methyl-3-[[2,3,4,5,6-pentakis[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methyl]imidazol-1-ium.
| Compound Name | 1-methyl-3-[[2,3,4,5,6-pentakis[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methyl]imidazol-1-ium |
|---|---|
| PubChem CID | 101387085 |
| Molecular Formula | C36H48N12+6 |
| Molecular Weight | 648.86 g/mol |
| Exact Mass | 648.41 |
| IUPAC Name | 1-methyl-3-[[2,3,4,5,6-pentakis[(3-methylimidazol-3-ium-1-yl)methyl]phenyl]methyl]imidazol-1-ium |
| SMILES | C[n+]1ccn(Cc2c(Cn3cc[n+](C)c3)c(Cn3cc[n+](C)c3)c(Cn3cc[n+](C)c3)c(Cn3cc[n+](C)c3)c2Cn2cc[n+](C)c2)c1 |
| InChI | InChI=1S/C36H48N12/c1-37-7-13-43(25-37)19-31-32(20-44-14-8-38(2)26-44)34(22-46-16-10-40(4)28-46)36(24-48-18-12-42(6)30-48)35(23-47-17-11-41(5)29-47)33(31)21-45-15-9-39(3)27-45/h7-18,25-30H,19-24H2,1-6H3/q+6 |
| InChIKey | FYBKSRGWGXXQBM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.86 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|