C21H31F3O8SSi — CID 101387333
[(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-methyl-4-(trifluoromethylsulfonyloxy)oxan-3-yl] benzoate (PubChem CID 101387333) has the molecular formula C21H31F3O8SSi and a molecular weight of 528.62 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-methyl-4-(trifluoromethylsulfonyloxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-methyl-4-(trifluoromethylsulfonyloxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101387333 |
| Molecular Formula | C21H31F3O8SSi |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-methyl-4-(trifluoromethylsulfonyloxy)oxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H31F3O8SSi/c1-13-15(32-34(6,7)20(2,3)4)16(31-33(26,27)21(22,23)24)17(19(28-5)29-13)30-18(25)14-11-9-8-10-12-14/h8-13,15-17,19H,1-7H3/t13-,15-,16-,17-,19+/m1/s1 |
| InChIKey | QYEUMVTWVFGKOW-PMTZBRRQSA-N |
| XLogP | 4.23 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|