About 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid (PubChem CID 10138779) has the molecular formula C21H17F7O3
and a molecular weight of 450.35 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid |
| PubChem CID | 10138779 |
| Molecular Formula | C21H17F7O3 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17F7O3/c22-15-3-1-12(2-4-15)18-16(19(29)30)5-6-17(18)31-10-11-7-13(20(23,24)25)9-14(8-11)21(26,27)28/h1-4,7-9,16-18H,5-6,10H2,(H,29,30) |
| InChIKey | YRILEJDGNZQZFZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid?
The IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid (CID 10138779) is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid is O=C(O)C1CCC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccc(F)cc1.
What is the InChIKey of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid?
The InChIKey is YRILEJDGNZQZFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F7O3/c22-15-3-1-12(2-4-15)18-16(19(29)30)5-6-17(18)31-10-11-7-13(20(23,24)25)9-14(8-11)21(26,27)28/h1-4,7-9,16-18H,5-6,10H2,(H,29,30).
What are the key properties of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid?
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid has a molecular weight of 450.35 g/mol, XLogP of 6.03, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 10138779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).