C26H24F2N2O3 — CID 10138792
2-methoxyethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate (PubChem CID 10138792) has the molecular formula C26H24F2N2O3 and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 10138792 |
| Molecular Formula | C26H24F2N2O3 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-methoxyethyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1ccc(-c2ccc(C3CCC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C26H24F2N2O3/c1-32-15-16-33-26(31)29-20-11-9-18(10-12-20)17-5-7-19(8-6-17)23-13-14-24(30-23)25-21(27)3-2-4-22(25)28/h2-12,23H,13-16H2,1H3,(H,29,31) |
| InChIKey | UTPWPSHNGUHKBJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|