C9H13F3O — CID 101388261
trans-(1S,2R)-2-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexan-1-ol (PubChem CID 101388261) has the molecular formula C9H13F3O and a molecular weight of 194.20 g/mol. Its IUPAC name is trans-(1S,2R)-2-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2R)-2-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 101388261 |
| Molecular Formula | C9H13F3O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | trans-(1S,2R)-2-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexan-1-ol |
| SMILES | C=C([C@H]1CCCC[C@@H]1O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O/c1-6(9(10,11)12)7-4-2-3-5-8(7)13/h7-8,13H,1-5H2/t7-,8+/m1/s1 |
| InChIKey | BCDYNEWSLIGOJV-SFYZADRCSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|