C22H21N5O5 — CID 101388306
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(4-phenoxyanilino)purin-9-yl]oxolane-3,4-diol (PubChem CID 101388306) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(4-phenoxyanilino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(4-phenoxyanilino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 101388306 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(4-phenoxyanilino)purin-9-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(Nc4ccc(Oc5ccccc5)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H21N5O5/c28-10-16-18(29)19(30)22(32-16)27-12-25-17-20(23-11-24-21(17)27)26-13-6-8-15(9-7-13)31-14-4-2-1-3-5-14/h1-9,11-12,16,18-19,22,28-30H,10H2,(H,23,24,26)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | OPXHNNVGFZOYCX-WGQQHEPDSA-N |
| XLogP | 1.97 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |