C22H32O4 — CID 101388555
(2'R,6'R,9'R,12'R,13'S,18'R)-4',4'-dimethylspiro[1,3-dioxolane-2,14'-3,5-dioxapentacyclo[10.8.0.02,6.02,9.013,18]icos-1(20)-ene] (PubChem CID 101388555) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2'R,6'R,9'R,12'R,13'S,18'R)-4',4'-dimethylspiro[1,3-dioxolane-2,14'-3,5-dioxapentacyclo[10.8.0.02,6.02,9.013,18]icos-1(20)-ene].
| Compound Name | (2'R,6'R,9'R,12'R,13'S,18'R)-4',4'-dimethylspiro[1,3-dioxolane-2,14'-3,5-dioxapentacyclo[10.8.0.02,6.02,9.013,18]icos-1(20)-ene] |
|---|---|
| PubChem CID | 101388555 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2'R,6'R,9'R,12'R,13'S,18'R)-4',4'-dimethylspiro[1,3-dioxolane-2,14'-3,5-dioxapentacyclo[10.8.0.02,6.02,9.013,18]icos-1(20)-ene] |
| SMILES | CC1(C)O[C@@H]2CC[C@H]3CC[C@H]4C(=CC[C@H]5CCCC6(OCCO6)[C@@H]54)[C@]32O1 |
| InChI | InChI=1S/C22H32O4/c1-20(2)25-18-10-7-15-6-8-16-17(22(15,18)26-20)9-5-14-4-3-11-21(19(14)16)23-12-13-24-21/h9,14-16,18-19H,3-8,10-13H2,1-2H3/t14-,15-,16+,18-,19+,22-/m1/s1 |
| InChIKey | BREADQRFKSRWRA-CTITXYIYSA-N |
| XLogP | 4.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|