C10H12Br2O — CID 101388569
1-[(1R,2S)-1,2-dibromopropyl]-4-methoxybenzene (PubChem CID 101388569) has the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. Its IUPAC name is 1-[(1R,2S)-1,2-dibromopropyl]-4-methoxybenzene.
| Compound Name | 1-[(1R,2S)-1,2-dibromopropyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 101388569 |
| Molecular Formula | C10H12Br2O |
| Molecular Weight | 308.01 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 1-[(1R,2S)-1,2-dibromopropyl]-4-methoxybenzene |
| SMILES | COc1ccc([C@@H](Br)[C@H](C)Br)cc1 |
| InChI | InChI=1S/C10H12Br2O/c1-7(11)10(12)8-3-5-9(13-2)6-4-8/h3-7,10H,1-2H3/t7-,10-/m0/s1 |
| InChIKey | YBNDQTKOLHGZOP-XVKPBYJWSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.01 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|