About (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone
(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone (PubChem CID 101388679) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone |
| PubChem CID | 101388679 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)C2CC(C)(C)Oc3cc(OC)ccc32)c1 |
| InChI | InChI=1S/C20H22O4/c1-20(2)12-17(16-9-8-15(23-4)11-18(16)24-20)19(21)13-6-5-7-14(10-13)22-3/h5-11,17H,12H2,1-4H3 |
| InChIKey | VMIPLLOHTSJMCN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone?
The IUPAC name of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone (CID 101388679) is (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone.
What is the SMILES notation for (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone?
The canonical SMILES for (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone is COc1cccc(C(=O)C2CC(C)(C)Oc3cc(OC)ccc32)c1.
What is the InChIKey of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone?
The InChIKey is VMIPLLOHTSJMCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O4/c1-20(2)12-17(16-9-8-15(23-4)11-18(16)24-20)19(21)13-6-5-7-14(10-13)22-3/h5-11,17H,12H2,1-4H3.
What are the key properties of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone?
(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone has a molecular weight of 326.39 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-(3-methoxyphenyl)methanone is sourced from PubChem (CID 101388679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).