C21H40OS4Si — CID 101388825
tert-butyl-dimethyl-[(2S)-1-(2-methyl-1,3-dithian-2-yl)-3-(2-prop-2-enyl-1,3-dithian-2-yl)propan-2-yl]oxysilane (PubChem CID 101388825) has the molecular formula C21H40OS4Si and a molecular weight of 464.90 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S)-1-(2-methyl-1,3-dithian-2-yl)-3-(2-prop-2-enyl-1,3-dithian-2-yl)propan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S)-1-(2-methyl-1,3-dithian-2-yl)-3-(2-prop-2-enyl-1,3-dithian-2-yl)propan-2-yl]oxysilane |
|---|---|
| PubChem CID | 101388825 |
| Molecular Formula | C21H40OS4Si |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | tert-butyl-dimethyl-[(2S)-1-(2-methyl-1,3-dithian-2-yl)-3-(2-prop-2-enyl-1,3-dithian-2-yl)propan-2-yl]oxysilane |
| SMILES | C=CCC1(C[C@H](CC2(C)SCCCS2)O[Si](C)(C)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C21H40OS4Si/c1-8-11-21(25-14-10-15-26-21)17-18(22-27(6,7)19(2,3)4)16-20(5)23-12-9-13-24-20/h8,18H,1,9-17H2,2-7H3/t18-/m0/s1 |
| InChIKey | CEWJOFDVVWOAFT-SFHVURJKSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|