About methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate
methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate (PubChem CID 101389442) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate.
Molecular Properties
| Compound Name | methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate |
| PubChem CID | 101389442 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate |
| SMILES | C=C/C=C(\COC(C)=O)[C@](O)(CC)C(=O)OC |
| InChI | InChI=1S/C12H18O5/c1-5-7-10(8-17-9(3)13)12(15,6-2)11(14)16-4/h5,7,15H,1,6,8H2,2-4H3/b10-7+/t12-/m1/s1 |
| InChIKey | RVAOJXQYAJDBTG-OFFHKIPUSA-N |
| XLogP | 0.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate?
The IUPAC name of methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate (CID 101389442) is methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate.
What is the SMILES notation for methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate?
The canonical SMILES for methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate is C=C/C=C(\COC(C)=O)[C@](O)(CC)C(=O)OC.
What is the InChIKey of methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate?
The InChIKey is RVAOJXQYAJDBTG-OFFHKIPUSA-N. The full InChI is InChI=1S/C12H18O5/c1-5-7-10(8-17-9(3)13)12(15,6-2)11(14)16-4/h5,7,15H,1,6,8H2,2-4H3/b10-7+/t12-/m1/s1.
What are the key properties of methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate?
methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate has a molecular weight of 242.27 g/mol, XLogP of 0.98, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3E)-3-(acetyloxymethyl)-2-ethyl-2-hydroxyhexa-3,5-dienoate is sourced from PubChem (CID 101389442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).