C32H32O10 — CID 101389900
methyl (2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(trityloxymethyl)oxolane-2-carboxylate (PubChem CID 101389900) has the molecular formula C32H32O10 and a molecular weight of 576.60 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(trityloxymethyl)oxolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(trityloxymethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 101389900 |
| Molecular Formula | C32H32O10 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | methyl (2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(trityloxymethyl)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC(C)=O)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H32O10/c1-21(33)39-28-27(42-32(30(36)37-4,41-23(3)35)29(28)40-22(2)34)20-38-31(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,27-29H,20H2,1-4H3/t27-,28-,29+,32-/m1/s1 |
| InChIKey | NQIGZXCWIRVVPR-YZALVSPHSA-N |
| XLogP | 3.69 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|