C21H30O2 — CID 101390164
2-[(3E)-3,7-dimethylocta-3,6-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one (PubChem CID 101390164) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-[(3E)-3,7-dimethylocta-3,6-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one.
| Compound Name | 2-[(3E)-3,7-dimethylocta-3,6-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one |
|---|---|
| PubChem CID | 101390164 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 2-[(3E)-3,7-dimethylocta-3,6-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one |
| SMILES | CC(C)=CC/C=C(\C)CCC1(C)C=CC2=C(CC(C)CC2=O)O1 |
| InChI | InChI=1S/C21H30O2/c1-15(2)7-6-8-16(3)9-11-21(5)12-10-18-19(22)13-17(4)14-20(18)23-21/h7-8,10,12,17H,6,9,11,13-14H2,1-5H3/b16-8+ |
| InChIKey | UOWOUGZXYWGOOB-LZYBPNLTSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|