C24H40O4Si — CID 101390397
[(2E,5E,7E)-7-[(4S,5R)-5-[(E)-but-2-en-2-yl]-4-methyl-2,2-di(propan-2-yl)oxasilolan-3-ylidene]-3-methylhepta-2,5-dienyl] methyl carbonate (PubChem CID 101390397) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is [(2E,5E,7E)-7-[(4S,5R)-5-[(E)-but-2-en-2-yl]-4-methyl-2,2-di(propan-2-yl)oxasilolan-3-ylidene]-3-methylhepta-2,5-dienyl] methyl carbonate.
| Compound Name | [(2E,5E,7E)-7-[(4S,5R)-5-[(E)-but-2-en-2-yl]-4-methyl-2,2-di(propan-2-yl)oxasilolan-3-ylidene]-3-methylhepta-2,5-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 101390397 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | [(2E,5E,7E)-7-[(4S,5R)-5-[(E)-but-2-en-2-yl]-4-methyl-2,2-di(propan-2-yl)oxasilolan-3-ylidene]-3-methylhepta-2,5-dienyl] methyl carbonate |
| SMILES | C/C=C(\C)[C@@H]1O[Si](C(C)C)(C(C)C)/C(=C/C=C/C/C(C)=C/COC(=O)OC)[C@H]1C |
| InChI | InChI=1S/C24H40O4Si/c1-10-20(7)23-21(8)22(29(28-23,17(2)3)18(4)5)14-12-11-13-19(6)15-16-27-24(25)26-9/h10-12,14-15,17-18,21,23H,13,16H2,1-9H3/b12-11+,19-15+,20-10+,22-14+/t21-,23+/m1/s1 |
| InChIKey | QRRVSNRRTPMYNX-ZMOGQDCOSA-N |
| XLogP | 6.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|