C30H22F12NP — CID 101390430
(1S)-1-[5-bis[2,4-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine (PubChem CID 101390430) has the molecular formula C30H22F12NP and a molecular weight of 655.46 g/mol. Its IUPAC name is (1S)-1-[5-bis[2,4-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine.
| Compound Name | (1S)-1-[5-bis[2,4-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 101390430 |
| Molecular Formula | C30H22F12NP |
| Molecular Weight | 655.46 g/mol |
| Exact Mass | 655.13 |
| IUPAC Name | (1S)-1-[5-bis[2,4-bis(trifluoromethyl)phenyl]phosphanylcyclopenta-1,3-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine |
| SMILES | CN(C)[C@H](C1=CC=CC1P(c1ccc(C(F)(F)F)cc1C(F)(F)F)c1ccc(C(F)(F)F)cc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C30H22F12NP/c1-43(2)26(17-7-4-3-5-8-17)20-9-6-10-23(20)44(24-13-11-18(27(31,32)33)15-21(24)29(37,38)39)25-14-12-19(28(34,35)36)16-22(25)30(40,41)42/h3-16,23,26H,1-2H3/t23?,26-/m0/s1 |
| InChIKey | GYHFELJOVOKCHG-NASUQTAISA-N |
| XLogP | 9.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.46 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|