C19H16F6N2O4 — CID 101390998
ethyl (3R,6R,7aS)-6-(2-cyano-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 101390998) has the molecular formula C19H16F6N2O4 and a molecular weight of 450.34 g/mol. Its IUPAC name is ethyl (3R,6R,7aS)-6-(2-cyano-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,6R,7aS)-6-(2-cyano-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 101390998 |
| Molecular Formula | C19H16F6N2O4 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | ethyl (3R,6R,7aS)-6-(2-cyano-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(C#N)(C(F)(F)F)C(F)(F)F)C[C@H]2CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C19H16F6N2O4/c1-2-30-15(29)16(17(10-26,18(20,21)22)19(23,24)25)8-12-9-31-13(27(12)14(16)28)11-6-4-3-5-7-11/h3-7,12-13H,2,8-9H2,1H3/t12-,13+,16+/m0/s1 |
| InChIKey | MGTVCIPEMJGIOO-WOSRLPQWSA-N |
| XLogP | 3.50 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|