C17H16ClNO — CID 101391113
4-[(1S,3S)-3-chloro-1-hydroxy-3-(4-methylphenyl)propyl]benzonitrile (PubChem CID 101391113) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 4-[(1S,3S)-3-chloro-1-hydroxy-3-(4-methylphenyl)propyl]benzonitrile.
| Compound Name | 4-[(1S,3S)-3-chloro-1-hydroxy-3-(4-methylphenyl)propyl]benzonitrile |
|---|---|
| PubChem CID | 101391113 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-[(1S,3S)-3-chloro-1-hydroxy-3-(4-methylphenyl)propyl]benzonitrile |
| SMILES | Cc1ccc([C@@H](Cl)C[C@H](O)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C17H16ClNO/c1-12-2-6-14(7-3-12)16(18)10-17(20)15-8-4-13(11-19)5-9-15/h2-9,16-17,20H,10H2,1H3/t16-,17-/m0/s1 |
| InChIKey | QBCJRPIYRJHLIS-IRXDYDNUSA-N |
| XLogP | 4.27 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|