C24H48O5Si3 — CID 101391348
(2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol (PubChem CID 101391348) has the molecular formula C24H48O5Si3 and a molecular weight of 500.90 g/mol. Its IUPAC name is (2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol.
| Compound Name | (2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol |
|---|---|
| PubChem CID | 101391348 |
| Molecular Formula | C24H48O5Si3 |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | (2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol |
| SMILES | C[C@@]1([Si](C)(C)C)O[C@@H]1C[C@@]1([Si](C)(C)C)O[C@@H]1C[C@@]1([Si](C)(C)C)O[C@@H]1C[C@@H]1OCCC[C@H]1O |
| InChI | InChI=1S/C24H48O5Si3/c1-22(30(2,3)4)20(27-22)15-24(32(8,9)10)21(29-24)16-23(31(5,6)7)19(28-23)14-18-17(25)12-11-13-26-18/h17-21,25H,11-16H2,1-10H3/t17-,18+,19-,20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | DMZUWZQJRLGDHL-RYBPNGNFSA-N |
| XLogP | 4.76 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|