C18H36O4Si2 — CID 101391352
(2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol (PubChem CID 101391352) has the molecular formula C18H36O4Si2 and a molecular weight of 372.65 g/mol. Its IUPAC name is (2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol.
| Compound Name | (2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol |
|---|---|
| PubChem CID | 101391352 |
| Molecular Formula | C18H36O4Si2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (2S,3R)-2-[[(2R,3S)-3-[[(2R,3S)-3-methyl-3-trimethylsilyloxiran-2-yl]methyl]-3-trimethylsilyloxiran-2-yl]methyl]oxan-3-ol |
| SMILES | C[C@@]1([Si](C)(C)C)O[C@@H]1C[C@@]1([Si](C)(C)C)O[C@@H]1C[C@@H]1OCCC[C@H]1O |
| InChI | InChI=1S/C18H36O4Si2/c1-17(23(2,3)4)16(21-17)12-18(24(5,6)7)15(22-18)11-14-13(19)9-8-10-20-14/h13-16,19H,8-12H2,1-7H3/t13-,14+,15-,16-,17+,18+/m1/s1 |
| InChIKey | YHYCKHDJJVYIOF-SUMCQTLJSA-N |
| XLogP | 3.36 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|