C18H24N2O5 — CID 101392067
(E)-N-[[(1S,2S,4S)-2-hydroxy-4-phenylmethoxycyclohexyl]carbamoyl]-3-methoxyprop-2-enamide (PubChem CID 101392067) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is (E)-N-[[(1S,2S,4S)-2-hydroxy-4-phenylmethoxycyclohexyl]carbamoyl]-3-methoxyprop-2-enamide.
| Compound Name | (E)-N-[[(1S,2S,4S)-2-hydroxy-4-phenylmethoxycyclohexyl]carbamoyl]-3-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 101392067 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (E)-N-[[(1S,2S,4S)-2-hydroxy-4-phenylmethoxycyclohexyl]carbamoyl]-3-methoxyprop-2-enamide |
| SMILES | CO/C=C/C(=O)NC(=O)N[C@H]1CC[C@H](OCc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C18H24N2O5/c1-24-10-9-17(22)20-18(23)19-15-8-7-14(11-16(15)21)25-12-13-5-3-2-4-6-13/h2-6,9-10,14-16,21H,7-8,11-12H2,1H3,(H2,19,20,22,23)/b10-9+/t14-,15-,16-/m0/s1 |
| InChIKey | QFCQORLATAUZFW-KEOMUINKSA-N |
| XLogP | 1.47 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|