C27H32N6O — CID 10139208
4-[[6-[(4-phenylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol (PubChem CID 10139208) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-[[6-[(4-phenylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-[(4-phenylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10139208 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 4-[[6-[(4-phenylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CC(C)n1cnc2c(NCc3ccc(-c4ccccc4)cc3)nc(NC3CCC(O)CC3)nc21 |
| InChI | InChI=1S/C27H32N6O/c1-18(2)33-17-29-24-25(31-27(32-26(24)33)30-22-12-14-23(34)15-13-22)28-16-19-8-10-21(11-9-19)20-6-4-3-5-7-20/h3-11,17-18,22-23,34H,12-16H2,1-2H3,(H2,28,30,31,32) |
| InChIKey | QSWCDWIAXDNCCG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |