About [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate
[(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 101392343) has the molecular formula C18H20F3IO4SSi
and a molecular weight of 544.41 g/mol. Its IUPAC name is [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
| PubChem CID | 101392343 |
| Molecular Formula | C18H20F3IO4SSi |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | CC(=O)c1ccc([Si](C)(C)C)c(I(OS(=O)(=O)C(F)(F)F)c2ccccc2)c1 |
| InChI | InChI=1S/C18H20F3IO4SSi/c1-13(23)14-10-11-17(28(2,3)4)16(12-14)22(15-8-6-5-7-9-15)26-27(24,25)18(19,20)21/h5-12H,1-4H3 |
| InChIKey | UYBSYHYDDYNXLK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
The IUPAC name of [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate (CID 101392343) is [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate.
What is the SMILES notation for [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
The canonical SMILES for [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate is CC(=O)c1ccc([Si](C)(C)C)c(I(OS(=O)(=O)C(F)(F)F)c2ccccc2)c1.
What is the InChIKey of [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
The InChIKey is UYBSYHYDDYNXLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F3IO4SSi/c1-13(23)14-10-11-17(28(2,3)4)16(12-14)22(15-8-6-5-7-9-15)26-27(24,25)18(19,20)21/h5-12H,1-4H3.
What are the key properties of [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate?
[(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate has a molecular weight of 544.41 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-acetyl-2-trimethylsilylphenyl)-phenyl-λ3-iodanyl] trifluoromethanesulfonate is sourced from PubChem (CID 101392343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).