C19H26N2O6S — CID 101392418
ethyl (2R)-2-[[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-2-hydroxyethyl]amino]-4-methylsulfanylbutanoate (PubChem CID 101392418) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-2-hydroxyethyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | ethyl (2R)-2-[[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-2-hydroxyethyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 101392418 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | ethyl (2R)-2-[[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-2-hydroxyethyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)[C@@H](CCSC)NCC(O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H26N2O6S/c1-3-26-19(25)15(8-11-28-2)20-12-16(22)27-10-9-21-17(23)13-6-4-5-7-14(13)18(21)24/h4-7,15-16,20,22H,3,8-12H2,1-2H3/t15-,16?/m1/s1 |
| InChIKey | NYPIDRGCBNYNLD-AAFJCEBUSA-N |
| XLogP | 0.89 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|