C25H34O4 — CID 101392447
[(1S,2S,3R,4S)-7,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-phenyloxirane-2-carboxylate (PubChem CID 101392447) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is [(1S,2S,3R,4S)-7,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-phenyloxirane-2-carboxylate.
| Compound Name | [(1S,2S,3R,4S)-7,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-phenyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 101392447 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [(1S,2S,3R,4S)-7,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-phenyloxirane-2-carboxylate |
| SMILES | C=CC[C@]12CC[C@H]([C@@H](OC(C)(C)C)[C@H]1OC(=O)C1(c3ccccc3)CO1)C2(C)C |
| InChI | InChI=1S/C25H34O4/c1-7-14-24-15-13-18(23(24,5)6)19(29-22(2,3)4)20(24)28-21(26)25(16-27-25)17-11-9-8-10-12-17/h7-12,18-20H,1,13-16H2,2-6H3/t18-,19-,20-,24+,25?/m1/s1 |
| InChIKey | JMWOBBAYEPDRSB-PSCLTHAASA-N |
| XLogP | 5.02 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|