C22H40O6Si2 — CID 101392897
2,5-bis[3-[diethoxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 101392897) has the molecular formula C22H40O6Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is 2,5-bis[3-[diethoxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[3-[diethoxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 101392897 |
| Molecular Formula | C22H40O6Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2,5-bis[3-[diethoxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCO[Si](C)(CCCC1=CC(=O)C(CCC[Si](C)(OCC)OCC)=CC1=O)OCC |
| InChI | InChI=1S/C22H40O6Si2/c1-7-25-29(5,26-8-2)15-11-13-19-17-22(24)20(18-21(19)23)14-12-16-30(6,27-9-3)28-10-4/h17-18H,7-16H2,1-6H3 |
| InChIKey | CHQFRSRTNXOKKV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|