C14H24O6Si2 — CID 101392899
2,5-bis[3-[dihydroxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 101392899) has the molecular formula C14H24O6Si2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 2,5-bis[3-[dihydroxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[3-[dihydroxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 101392899 |
| Molecular Formula | C14H24O6Si2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2,5-bis[3-[dihydroxy(methyl)silyl]propyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | C[Si](O)(O)CCCC1=CC(=O)C(CCC[Si](C)(O)O)=CC1=O |
| InChI | InChI=1S/C14H24O6Si2/c1-21(17,18)7-3-5-11-9-14(16)12(10-13(11)15)6-4-8-22(2,19)20/h9-10,17-20H,3-8H2,1-2H3 |
| InChIKey | UBHMCMLSORIRLO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|