C15H28OSi — CID 101393439
[(2E,5E)-3,5-dimethylhepta-2,5-dien-4-yl]oxymethyl-dimethyl-prop-2-enylsilane (PubChem CID 101393439) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is [(2E,5E)-3,5-dimethylhepta-2,5-dien-4-yl]oxymethyl-dimethyl-prop-2-enylsilane.
| Compound Name | [(2E,5E)-3,5-dimethylhepta-2,5-dien-4-yl]oxymethyl-dimethyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 101393439 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | [(2E,5E)-3,5-dimethylhepta-2,5-dien-4-yl]oxymethyl-dimethyl-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)COC(/C(C)=C/C)/C(C)=C/C |
| InChI | InChI=1S/C15H28OSi/c1-8-11-17(6,7)12-16-15(13(4)9-2)14(5)10-3/h8-10,15H,1,11-12H2,2-7H3/b13-9+,14-10+ |
| InChIKey | VTONOWBMDVWGIR-UTLPMFLDSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|