C26H9F9O6 — CID 101393933
5-[1-[3,5-bis(trifluoromethyl)phenyl]-1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoroethyl]-2-benzofuran-1,3-dione (PubChem CID 101393933) has the molecular formula C26H9F9O6 and a molecular weight of 588.33 g/mol. Its IUPAC name is 5-[1-[3,5-bis(trifluoromethyl)phenyl]-1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoroethyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[1-[3,5-bis(trifluoromethyl)phenyl]-1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoroethyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 101393933 |
| Molecular Formula | C26H9F9O6 |
| Molecular Weight | 588.33 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | 5-[1-[3,5-bis(trifluoromethyl)phenyl]-1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoroethyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(c3ccc4c(c3)C(=O)OC4=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C26H9F9O6/c27-24(28,29)13-5-12(6-14(7-13)25(30,31)32)23(26(33,34)35,10-1-3-15-17(8-10)21(38)40-19(15)36)11-2-4-16-18(9-11)22(39)41-20(16)37/h1-9H |
| InChIKey | FQHPSVJSGCFNPI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.33 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|