About (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene
(9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene (PubChem CID 101394623) has the molecular formula C37H32
and a molecular weight of 476.66 g/mol. Its IUPAC name is (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene.
Molecular Properties
| Compound Name | (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene |
| PubChem CID | 101394623 |
| Molecular Formula | C37H32 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)/C(=C/C(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C37H32/c1-36(2,3)30-23-24-33-31-21-13-14-22-32(31)35(34(33)25-30)26-37(27-15-7-4-8-16-27,28-17-9-5-10-18-28)29-19-11-6-12-20-29/h4-26H,1-3H3/b35-26+ |
| InChIKey | BXNCJMJXCQIJET-MDAYZVFASA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene?
The IUPAC name of (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene (CID 101394623) is (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene.
What is the SMILES notation for (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene?
The canonical SMILES for (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene is CC(C)(C)c1ccc2c(c1)/C(=C/C(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1-2.
What is the InChIKey of (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene?
The InChIKey is BXNCJMJXCQIJET-MDAYZVFASA-N. The full InChI is InChI=1S/C37H32/c1-36(2,3)30-23-24-33-31-21-13-14-22-32(31)35(34(33)25-30)26-37(27-15-7-4-8-16-27,28-17-9-5-10-18-28)29-19-11-6-12-20-29/h4-26H,1-3H3/b35-26+.
What are the key properties of (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene?
(9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene has a molecular weight of 476.66 g/mol, XLogP of 9.43, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (9E)-2-tert-butyl-9-(2,2,2-triphenylethylidene)fluorene is sourced from PubChem (CID 101394623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).