About 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid
2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid (PubChem CID 10139465) has the molecular formula C25H23F3O3S
and a molecular weight of 460.52 g/mol. Its IUPAC name is 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid.
Molecular Properties
| Compound Name | 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid |
| PubChem CID | 10139465 |
| Molecular Formula | C25H23F3O3S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid |
| SMILES | O=C(O)C(CC(O)CSc1ccccc1)CC(F)(F)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H23F3O3S/c26-21-12-8-18(9-13-21)17-6-10-20(11-7-17)25(27,28)15-19(24(30)31)14-22(29)16-32-23-4-2-1-3-5-23/h1-13,19,22,29H,14-16H2,(H,30,31) |
| InChIKey | AAEPZAWHHJRMOU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid?
The IUPAC name of 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid (CID 10139465) is 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid.
What is the SMILES notation for 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid?
The canonical SMILES for 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid is O=C(O)C(CC(O)CSc1ccccc1)CC(F)(F)c1ccc(-c2ccc(F)cc2)cc1.
What is the InChIKey of 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid?
The InChIKey is AAEPZAWHHJRMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23F3O3S/c26-21-12-8-18(9-13-21)17-6-10-20(11-7-17)25(27,28)15-19(24(30)31)14-22(29)16-32-23-4-2-1-3-5-23/h1-13,19,22,29H,14-16H2,(H,30,31).
What are the key properties of 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid?
2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid has a molecular weight of 460.52 g/mol, XLogP of 6.22, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoro-2-[4-(4-fluorophenyl)phenyl]ethyl]-4-hydroxy-5-phenylsulfanylpentanoic acid is sourced from PubChem (CID 10139465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).