C20H34O5 — CID 101394720
3-[(1S,4S,5R,6S,9R,10R)-10-hydroxy-10-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-5-methyl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid (PubChem CID 101394720) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 3-[(1S,4S,5R,6S,9R,10R)-10-hydroxy-10-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-5-methyl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid.
| Compound Name | 3-[(1S,4S,5R,6S,9R,10R)-10-hydroxy-10-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-5-methyl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid |
|---|---|
| PubChem CID | 101394720 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 3-[(1S,4S,5R,6S,9R,10R)-10-hydroxy-10-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)-5-methyl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid |
| SMILES | CC(C)(O)[C@H]1CC[C@@]23C[C@@H](CC[C@@H]2[C@@]1(C)CCC(=O)O)[C@@](O)(CO)C3 |
| InChI | InChI=1S/C20H34O5/c1-17(2,24)14-6-9-19-10-13(20(25,11-19)12-21)4-5-15(19)18(14,3)8-7-16(22)23/h13-15,21,24-25H,4-12H2,1-3H3,(H,22,23)/t13-,14-,15-,18+,19+,20+/m1/s1 |
| InChIKey | DDJDLXLOVVZKAD-SNDCPDFKSA-N |
| XLogP | 2.57 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |