C18H27NO4S — CID 101395207
[2-methyl-1-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propyl] acetate (PubChem CID 101395207) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is [2-methyl-1-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propyl] acetate.
| Compound Name | [2-methyl-1-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 101395207 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [2-methyl-1-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propyl] acetate |
| SMILES | CC(=O)OC(C(C)C)[C@@H]1CCCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H27NO4S/c1-13(2)18(23-15(4)20)17-7-5-6-12-19(17)24(21,22)16-10-8-14(3)9-11-16/h8-11,13,17-18H,5-7,12H2,1-4H3/t17-,18?/m0/s1 |
| InChIKey | YCNYZFDAWRYRMI-ZENAZSQFSA-N |
| XLogP | 3.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |