C21H29NO8S — CID 101395217
ethyl (2R,3S)-2,3-diacetyloxy-3-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propanoate (PubChem CID 101395217) has the molecular formula C21H29NO8S and a molecular weight of 455.53 g/mol. Its IUPAC name is ethyl (2R,3S)-2,3-diacetyloxy-3-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propanoate.
| Compound Name | ethyl (2R,3S)-2,3-diacetyloxy-3-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propanoate |
|---|---|
| PubChem CID | 101395217 |
| Molecular Formula | C21H29NO8S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | ethyl (2R,3S)-2,3-diacetyloxy-3-[(2S)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]propanoate |
| SMILES | CCOC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1CCCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H29NO8S/c1-5-28-21(25)20(30-16(4)24)19(29-15(3)23)18-8-6-7-13-22(18)31(26,27)17-11-9-14(2)10-12-17/h9-12,18-20H,5-8,13H2,1-4H3/t18-,19-,20+/m0/s1 |
| InChIKey | RBWGPJCSIHFBRS-SLFFLAALSA-N |
| XLogP | 1.96 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|