C23H22F3N3O4 — CID 10139522
3-[[[2-oxo-2-(2-oxo-4-phenylpiperidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]methyl]benzamide (PubChem CID 10139522) has the molecular formula C23H22F3N3O4 and a molecular weight of 461.44 g/mol. Its IUPAC name is 3-[[[2-oxo-2-(2-oxo-4-phenylpiperidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]methyl]benzamide.
| Compound Name | 3-[[[2-oxo-2-(2-oxo-4-phenylpiperidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 10139522 |
| Molecular Formula | C23H22F3N3O4 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-[[[2-oxo-2-(2-oxo-4-phenylpiperidin-1-yl)acetyl]-(2,2,2-trifluoroethyl)amino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CN(CC(F)(F)F)C(=O)C(=O)N2CCC(c3ccccc3)CC2=O)c1 |
| InChI | InChI=1S/C23H22F3N3O4/c24-23(25,26)14-28(13-15-5-4-8-18(11-15)20(27)31)21(32)22(33)29-10-9-17(12-19(29)30)16-6-2-1-3-7-16/h1-8,11,17H,9-10,12-14H2,(H2,27,31) |
| InChIKey | WHQGCJHVVKHLJT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|