C13H14F3NO4S — CID 101395251
ethyl (2S,3S)-1-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)aziridine-2-carboxylate (PubChem CID 101395251) has the molecular formula C13H14F3NO4S and a molecular weight of 337.32 g/mol. Its IUPAC name is ethyl (2S,3S)-1-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-1-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101395251 |
| Molecular Formula | C13H14F3NO4S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | ethyl (2S,3S)-1-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(F)(F)F)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H14F3NO4S/c1-3-21-12(18)10-11(13(14,15)16)17(10)22(19,20)9-6-4-8(2)5-7-9/h4-7,10-11H,3H2,1-2H3/t10-,11-,17?/m0/s1 |
| InChIKey | VSRKYHSFJKLBMG-BFNLLXIESA-N |
| XLogP | 1.86 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|