C24H32NO2P — CID 101395647
(4aS,7R,8aR)-2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine 2-oxide (PubChem CID 101395647) has the molecular formula C24H32NO2P and a molecular weight of 397.50 g/mol. Its IUPAC name is (4aS,7R,8aR)-2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine 2-oxide.
| Compound Name | (4aS,7R,8aR)-2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine 2-oxide |
|---|---|
| PubChem CID | 101395647 |
| Molecular Formula | C24H32NO2P |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (4aS,7R,8aR)-2,3-dibenzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine 2-oxide |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)OP(=O)(Cc1ccccc1)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C24H32NO2P/c1-19-14-15-22-23(16-19)27-28(26,18-21-12-8-5-9-13-21)25(24(22,2)3)17-20-10-6-4-7-11-20/h4-13,19,22-23H,14-18H2,1-3H3/t19-,22-,23-,28?/m1/s1 |
| InChIKey | SJBVZZPNGUTKHZ-CTYPDVBISA-N |
| XLogP | 6.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|