C66H60N6 — CID 101395892
2,4,6-tris[2-[4-[N-(3-methylbutyl)anilino]phenyl]ethynyl]benzene-1,3,5-tricarbonitrile (PubChem CID 101395892) has the molecular formula C66H60N6 and a molecular weight of 937.25 g/mol. Its IUPAC name is 2,4,6-tris[2-[4-[N-(3-methylbutyl)anilino]phenyl]ethynyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2,4,6-tris[2-[4-[N-(3-methylbutyl)anilino]phenyl]ethynyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 101395892 |
| Molecular Formula | C66H60N6 |
| Molecular Weight | 937.25 g/mol |
| Exact Mass | 936.49 |
| IUPAC Name | 2,4,6-tris[2-[4-[N-(3-methylbutyl)anilino]phenyl]ethynyl]benzene-1,3,5-tricarbonitrile |
| SMILES | CC(C)CCN(c1ccccc1)c1ccc(C#Cc2c(C#N)c(C#Cc3ccc(N(CCC(C)C)c4ccccc4)cc3)c(C#N)c(C#Cc3ccc(N(CCC(C)C)c4ccccc4)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C66H60N6/c1-49(2)40-43-70(55-16-10-7-11-17-55)58-31-22-52(23-32-58)28-37-61-64(46-67)62(38-29-53-24-33-59(34-25-53)71(44-41-50(3)4)56-18-12-8-13-19-56)66(48-69)63(65(61)47-68)39-30-54-26-35-60(36-27-54)72(45-42-51(5)6)57-20-14-9-15-21-57/h7-27,31-36,49-51H,40-45H2,1-6H3 |
| InChIKey | YEOBSWQYBJCUNG-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.25 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|