C15H16S8 — CID 101396029
5-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-ene (PubChem CID 101396029) has the molecular formula C15H16S8 and a molecular weight of 452.83 g/mol. Its IUPAC name is 5-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-ene.
| Compound Name | 5-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-ene |
|---|---|
| PubChem CID | 101396029 |
| Molecular Formula | C15H16S8 |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 451.90 |
| IUPAC Name | 5-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-ene |
| SMILES | C1CCC2SC3=C(SC(=C4SC5=C(SCCS5)S4)S3)SC2CC1 |
| InChI | InChI=1S/C15H16S8/c1-2-4-8-9(5-3-1)19-13-12(18-8)22-15(23-13)14-20-10-11(21-14)17-7-6-16-10/h8-9H,1-7H2 |
| InChIKey | ILOGLDDSVSPJEC-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |