C15H14N2S6 — CID 101396030
2-(2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-en-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine (PubChem CID 101396030) has the molecular formula C15H14N2S6 and a molecular weight of 414.69 g/mol. Its IUPAC name is 2-(2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-en-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine.
| Compound Name | 2-(2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-en-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 101396030 |
| Molecular Formula | C15H14N2S6 |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2-(2,4,6,8-tetrathiatricyclo[7.5.0.03,7]tetradec-3(7)-en-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine |
| SMILES | c1cnc2c(n1)SC(=C1SC3=C(S1)SC1CCCCCC1S3)S2 |
| InChI | InChI=1S/C15H14N2S6/c1-2-4-8-9(5-3-1)19-13-12(18-8)22-15(23-13)14-20-10-11(21-14)17-7-6-16-10/h6-9H,1-5H2 |
| InChIKey | ANKPBZPVDYVBSG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |