C21H30O5 — CID 101396219
dimethyl (3aZ,9Z)-6,6-diethyl-4,9-dimethyl-8-oxo-1,3,5,7-tetrahydrocyclopenta[8]annulene-2,2-dicarboxylate (PubChem CID 101396219) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is dimethyl (3aZ,9Z)-6,6-diethyl-4,9-dimethyl-8-oxo-1,3,5,7-tetrahydrocyclopenta[8]annulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aZ,9Z)-6,6-diethyl-4,9-dimethyl-8-oxo-1,3,5,7-tetrahydrocyclopenta[8]annulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101396219 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | dimethyl (3aZ,9Z)-6,6-diethyl-4,9-dimethyl-8-oxo-1,3,5,7-tetrahydrocyclopenta[8]annulene-2,2-dicarboxylate |
| SMILES | CCC1(CC)CC(=O)/C(C)=C2/CC(C(=O)OC)(C(=O)OC)C/C2=C(\C)C1 |
| InChI | InChI=1S/C21H30O5/c1-7-20(8-2)9-13(3)15-10-21(18(23)25-5,19(24)26-6)11-16(15)14(4)17(22)12-20/h7-12H2,1-6H3/b15-13-,16-14- |
| InChIKey | CTWUNMLYULUOQZ-VMNXYWKNSA-N |
| XLogP | 3.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|