About [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane
[(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101396453) has the molecular formula C23H46O2Si
and a molecular weight of 382.71 g/mol. Its IUPAC name is [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 101396453 |
| Molecular Formula | C23H46O2Si |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)=CCC[C@@](C)(O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CCC(C)(C)O1 |
| InChI | InChI=1S/C23H46O2Si/c1-17(2)13-12-15-23(11,21-14-16-22(9,10)24-21)25-26(18(3)4,19(5)6)20(7)8/h13,18-21H,12,14-16H2,1-11H3/t21-,23+/m0/s1 |
| InChIKey | CRFQHCSWGWBNQF-JTHBVZDNSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane (CID 101396453) is [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane is CC(C)=CCC[C@@](C)(O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CCC(C)(C)O1.
What is the InChIKey of [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is CRFQHCSWGWBNQF-JTHBVZDNSA-N. The full InChI is InChI=1S/C23H46O2Si/c1-17(2)13-12-15-23(11,21-14-16-22(9,10)24-21)25-26(18(3)4,19(5)6)20(7)8/h13,18-21H,12,14-16H2,1-11H3/t21-,23+/m0/s1.
What are the key properties of [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane?
[(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 382.71 g/mol, XLogP of 7.64, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-[(2S)-5,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 101396453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).